Benzene and substituted derivatives
Filtered Search Results
p-Fluorobenzyl Bromide,MP Biomedicals
CAS: 459-46-1 Molecular Formula: C7H6BrF Molecular Weight (g/mol): 189.03 MDL Number: MFCD00000359 InChI Key: NVNPLEPBDPJYRZ-UHFFFAOYSA-N Synonym: 4-fluorobenzyl bromide,1-bromomethyl-4-fluorobenzene,p-fluorobenzyl bromide,4-fluorobenzylbromide,benzene, 1-bromomethyl-4-fluoro,alpha-bromo-p-fluorotoluene,alpha-bromo-4-fluorotoluene,1-bromomethyl-4-fluoro-benzene,4-bromomethyl-1-fluorobenzene,para-fluorobenzyl bromide PubChem CID: 68021 IUPAC Name: 1-(bromomethyl)-4-fluorobenzene SMILES: FC1=CC=C(CBr)C=C1
| PubChem CID | 68021 |
|---|---|
| CAS | 459-46-1 |
| Molecular Weight (g/mol) | 189.03 |
| MDL Number | MFCD00000359 |
| SMILES | FC1=CC=C(CBr)C=C1 |
| Synonym | 4-fluorobenzyl bromide,1-bromomethyl-4-fluorobenzene,p-fluorobenzyl bromide,4-fluorobenzylbromide,benzene, 1-bromomethyl-4-fluoro,alpha-bromo-p-fluorotoluene,alpha-bromo-4-fluorotoluene,1-bromomethyl-4-fluoro-benzene,4-bromomethyl-1-fluorobenzene,para-fluorobenzyl bromide |
| IUPAC Name | 1-(bromomethyl)-4-fluorobenzene |
| InChI Key | NVNPLEPBDPJYRZ-UHFFFAOYSA-N |
| Molecular Formula | C7H6BrF |
N-Methyl-N-(2-thien-2-ylbenzyl)amine, 97%, Thermo Scientific™
CAS: 852180-66-6 Molecular Formula: C12H13NS Molecular Weight (g/mol): 203.303 MDL Number: MFCD07368538 InChI Key: MRKJJEJYTBOUTH-UHFFFAOYSA-N Synonym: n-methyl-n-2-thien-2-ylbenzyl amine,n-methyl-1-2-thiophen-2-ylphenyl methanamine,n-methyl-2-thien-2-ylbenzylamine,methyl 2-thiophen-2-yl phenyl methyl amine,n-methyl-1-2-thiophen-2-yl phenyl methanamine,d0a2yg,n-methyl-n-2-thiophen-2-ylbenzyl amine,methyl 2-2-thienyl phenyl methyl amine,benzenemethanamine,n-methyl-2-2-thienyl,benzenemethanamine, n-methyl-2-2-thienyl PubChem CID: 7060565 IUPAC Name: N-methyl-1-(2-thiophen-2-ylphenyl)methanamine SMILES: CNCC1=CC=CC=C1C2=CC=CS2
| PubChem CID | 7060565 |
|---|---|
| CAS | 852180-66-6 |
| Molecular Weight (g/mol) | 203.303 |
| MDL Number | MFCD07368538 |
| SMILES | CNCC1=CC=CC=C1C2=CC=CS2 |
| Synonym | n-methyl-n-2-thien-2-ylbenzyl amine,n-methyl-1-2-thiophen-2-ylphenyl methanamine,n-methyl-2-thien-2-ylbenzylamine,methyl 2-thiophen-2-yl phenyl methyl amine,n-methyl-1-2-thiophen-2-yl phenyl methanamine,d0a2yg,n-methyl-n-2-thiophen-2-ylbenzyl amine,methyl 2-2-thienyl phenyl methyl amine,benzenemethanamine,n-methyl-2-2-thienyl,benzenemethanamine, n-methyl-2-2-thienyl |
| IUPAC Name | N-methyl-1-(2-thiophen-2-ylphenyl)methanamine |
| InChI Key | MRKJJEJYTBOUTH-UHFFFAOYSA-N |
| Molecular Formula | C12H13NS |
2-Chlorobenzoyl chloride, 97%
CAS: 609-65-4 Molecular Formula: C7H4Cl2O Molecular Weight (g/mol): 175.01 MDL Number: MFCD00000660 InChI Key: ONIKNECPXCLUHT-UHFFFAOYSA-N Synonym: benzoyl chloride, 2-chloro,o-chlorobenzoyl chloride,chlorobenzoyl chloride,benzoyl chloride, o-chloro,ococ,2-chloro-benzoyl chloride,unii-jr29a4n74x,o-chlorobenzoylchloride,2-chlorobenzoylchloride,2-chlorobenzoic acid chloride PubChem CID: 69110 ChEBI: CHEBI:60719 IUPAC Name: 2-chlorobenzoyl chloride SMILES: ClC(=O)C1=CC=CC=C1Cl
| PubChem CID | 69110 |
|---|---|
| CAS | 609-65-4 |
| Molecular Weight (g/mol) | 175.01 |
| ChEBI | CHEBI:60719 |
| MDL Number | MFCD00000660 |
| SMILES | ClC(=O)C1=CC=CC=C1Cl |
| Synonym | benzoyl chloride, 2-chloro,o-chlorobenzoyl chloride,chlorobenzoyl chloride,benzoyl chloride, o-chloro,ococ,2-chloro-benzoyl chloride,unii-jr29a4n74x,o-chlorobenzoylchloride,2-chlorobenzoylchloride,2-chlorobenzoic acid chloride |
| IUPAC Name | 2-chlorobenzoyl chloride |
| InChI Key | ONIKNECPXCLUHT-UHFFFAOYSA-N |
| Molecular Formula | C7H4Cl2O |
2,4-Difluorobenzyl bromide, 98+%
CAS: 23915-07-3 Molecular Formula: C7H5BrF2 Molecular Weight (g/mol): 207.018 MDL Number: MFCD00011649 InChI Key: IBLMYGXJKQIGSN-UHFFFAOYSA-N Synonym: 2,4-difluorobenzyl bromide,1-bromomethyl-2,4-difluorobenzene,2,4-difluorobenzylbromide,alpha-bromo-2,4-difluorotoluene,benzene, 1-bromomethyl-2,4-difluoro,2,4-difluoro benzyl bromide,1-bromomethyl-2,4-difluoro-benzene,2-chloromethyl quinoline hcl salt,fr cf d1e,pubchem4911 PubChem CID: 90297 IUPAC Name: 1-(bromomethyl)-2,4-difluorobenzene SMILES: C1=CC(=C(C=C1F)F)CBr
| PubChem CID | 90297 |
|---|---|
| CAS | 23915-07-3 |
| Molecular Weight (g/mol) | 207.018 |
| MDL Number | MFCD00011649 |
| SMILES | C1=CC(=C(C=C1F)F)CBr |
| Synonym | 2,4-difluorobenzyl bromide,1-bromomethyl-2,4-difluorobenzene,2,4-difluorobenzylbromide,alpha-bromo-2,4-difluorotoluene,benzene, 1-bromomethyl-2,4-difluoro,2,4-difluoro benzyl bromide,1-bromomethyl-2,4-difluoro-benzene,2-chloromethyl quinoline hcl salt,fr cf d1e,pubchem4911 |
| IUPAC Name | 1-(bromomethyl)-2,4-difluorobenzene |
| InChI Key | IBLMYGXJKQIGSN-UHFFFAOYSA-N |
| Molecular Formula | C7H5BrF2 |
2-Cyanobenzoic acid, 94%
CAS: 3839-22-3 Molecular Formula: C8H5NO2 Molecular Weight (g/mol): 147.133 MDL Number: MFCD00045796 InChI Key: DTNSDCJFTHMDAK-UHFFFAOYSA-N Synonym: o-cyanobenzoic acid,cyanobenzoic acid,benzoic acid, 2-cyano,2-carboxybenzonitrile,2-carboxy-benzonitrile,2-cyanobenzoicacid,2-cyano-benzoic acid,pubchem12513,acmc-1bn2v PubChem CID: 138061 IUPAC Name: 2-cyanobenzoic acid SMILES: C1=CC=C(C(=C1)C#N)C(=O)O
| PubChem CID | 138061 |
|---|---|
| CAS | 3839-22-3 |
| Molecular Weight (g/mol) | 147.133 |
| MDL Number | MFCD00045796 |
| SMILES | C1=CC=C(C(=C1)C#N)C(=O)O |
| Synonym | o-cyanobenzoic acid,cyanobenzoic acid,benzoic acid, 2-cyano,2-carboxybenzonitrile,2-carboxy-benzonitrile,2-cyanobenzoicacid,2-cyano-benzoic acid,pubchem12513,acmc-1bn2v |
| IUPAC Name | 2-cyanobenzoic acid |
| InChI Key | DTNSDCJFTHMDAK-UHFFFAOYSA-N |
| Molecular Formula | C8H5NO2 |
Methyl 3-cyano-4-methoxybenzoate, 97%
CAS: 25978-74-9 Molecular Formula: C10H9NO3 Molecular Weight (g/mol): 191.186 MDL Number: MFCD00052930 InChI Key: RYJSFYBJYKFNCF-UHFFFAOYSA-N Synonym: benzoic acid, 3-cyano-4-methoxy-, methyl ester,acmc-1cj4t,methyl 3-cyano-4-methoxy-benzoate,methyl 3-cyano-4-methoxybenzoate.,methyl 3-cyano-4-methyloxy benzoate,3-cyano-4-methoxy-benzoic acid methyl ester,benzoicacid,3-cyano-4-methoxy-,methyl ester PubChem CID: 2801011 IUPAC Name: methyl 3-cyano-4-methoxybenzoate SMILES: COC1=C(C=C(C=C1)C(=O)OC)C#N
| PubChem CID | 2801011 |
|---|---|
| CAS | 25978-74-9 |
| Molecular Weight (g/mol) | 191.186 |
| MDL Number | MFCD00052930 |
| SMILES | COC1=C(C=C(C=C1)C(=O)OC)C#N |
| Synonym | benzoic acid, 3-cyano-4-methoxy-, methyl ester,acmc-1cj4t,methyl 3-cyano-4-methoxy-benzoate,methyl 3-cyano-4-methoxybenzoate.,methyl 3-cyano-4-methyloxy benzoate,3-cyano-4-methoxy-benzoic acid methyl ester,benzoicacid,3-cyano-4-methoxy-,methyl ester |
| IUPAC Name | methyl 3-cyano-4-methoxybenzoate |
| InChI Key | RYJSFYBJYKFNCF-UHFFFAOYSA-N |
| Molecular Formula | C10H9NO3 |
3,4-Dichlorobenzyl bromide, 98%
CAS: 18880-04-1 Molecular Formula: C7H5BrCl2 Molecular Weight (g/mol): 239.921 MDL Number: MFCD00041363 InChI Key: XLWSBDFQAJXCQX-UHFFFAOYSA-N Synonym: 3,4-dichlorobenzyl bromide,4-bromomethyl-1,2-dichlorobenzene,benzene, 4-bromomethyl-1,2-dichloro,3,4-dichlorobenzylbromide,alpha-bromo-3,4-dichlorotoluene,acmc-209erq,3,4 dichlorobenzyl bromide,3,4-dichloro-benzyl bromide,ksc493a6b,timtec-bb sbb005763 PubChem CID: 639726 IUPAC Name: 4-(bromomethyl)-1,2-dichlorobenzene SMILES: C1=CC(=C(C=C1CBr)Cl)Cl
| PubChem CID | 639726 |
|---|---|
| CAS | 18880-04-1 |
| Molecular Weight (g/mol) | 239.921 |
| MDL Number | MFCD00041363 |
| SMILES | C1=CC(=C(C=C1CBr)Cl)Cl |
| Synonym | 3,4-dichlorobenzyl bromide,4-bromomethyl-1,2-dichlorobenzene,benzene, 4-bromomethyl-1,2-dichloro,3,4-dichlorobenzylbromide,alpha-bromo-3,4-dichlorotoluene,acmc-209erq,3,4 dichlorobenzyl bromide,3,4-dichloro-benzyl bromide,ksc493a6b,timtec-bb sbb005763 |
| IUPAC Name | 4-(bromomethyl)-1,2-dichlorobenzene |
| InChI Key | XLWSBDFQAJXCQX-UHFFFAOYSA-N |
| Molecular Formula | C7H5BrCl2 |
2,4,6-Trimethylbenzyl alcohol, 98+%
CAS: 4170-90-5 Molecular Formula: C10H14O Molecular Weight (g/mol): 150.221 MDL Number: MFCD00014422 InChI Key: LODDFDHPSIYCTK-UHFFFAOYSA-N Synonym: 2,4,6-trimethylbenzyl alcohol,mesitylmethanol,mesitylcarbinol,2,4,6-trimethylphenyl methanol,unii-rev3kvt84n,benzenemethanol, 2,4,6-trimethyl,2,4,6-trimethylbenzylic alcohol,benzyl alcohol, 2,4,6-trimethyl,rev3kvt84n,2,4,6-trimethylphenyl methan-1-ol PubChem CID: 20139 IUPAC Name: (2,4,6-trimethylphenyl)methanol SMILES: CC1=CC(=C(C(=C1)C)CO)C
| PubChem CID | 20139 |
|---|---|
| CAS | 4170-90-5 |
| Molecular Weight (g/mol) | 150.221 |
| MDL Number | MFCD00014422 |
| SMILES | CC1=CC(=C(C(=C1)C)CO)C |
| Synonym | 2,4,6-trimethylbenzyl alcohol,mesitylmethanol,mesitylcarbinol,2,4,6-trimethylphenyl methanol,unii-rev3kvt84n,benzenemethanol, 2,4,6-trimethyl,2,4,6-trimethylbenzylic alcohol,benzyl alcohol, 2,4,6-trimethyl,rev3kvt84n,2,4,6-trimethylphenyl methan-1-ol |
| IUPAC Name | (2,4,6-trimethylphenyl)methanol |
| InChI Key | LODDFDHPSIYCTK-UHFFFAOYSA-N |
| Molecular Formula | C10H14O |
Sodium Salicylate, Crystal, USP, 98-102%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 54-21-7 Molecular Formula: C7H5NaO3 Molecular Weight (g/mol): 160.10 InChI Key: ABBQHOQBGMUPJH-UHFFFAOYSA-M IUPAC Name: sodium 2-hydroxybenzoate SMILES: [Na+].OC1=CC=CC=C1C([O-])=O
| CAS | 54-21-7 |
|---|---|
| Molecular Weight (g/mol) | 160.10 |
| SMILES | [Na+].OC1=CC=CC=C1C([O-])=O |
| IUPAC Name | sodium 2-hydroxybenzoate |
| InChI Key | ABBQHOQBGMUPJH-UHFFFAOYSA-M |
| Molecular Formula | C7H5NaO3 |
Methyl 3-methoxy-2-nitrobenzoate, 98%, Thermo Scientific Chemicals
CAS: 5307-17-5 Molecular Formula: C9H9NO5 Molecular Weight (g/mol): 211.17 MDL Number: MFCD00051968 InChI Key: FDQQRLPHAAICCR-UHFFFAOYSA-N Synonym: benzoic acid, 3-methoxy-2-nitro-, methyl ester,3-methoxy-2-nitrobenzoic acid methyl ester,m-anisic acid, 2-nitro-, methyl ester,maybridge1_002124,cbmicro_008502,methyl 2-nitro-m-anisate,methyl 3-methoxy-2-nitro-benzoate,2-nitro-m-anisic acid methyl ester,3-methoxy-2-nitro-benzoic acid methyl ester PubChem CID: 79195 IUPAC Name: methyl 3-methoxy-2-nitrobenzoate SMILES: COC(=O)C1=CC=CC(OC)=C1[N+]([O-])=O
| PubChem CID | 79195 |
|---|---|
| CAS | 5307-17-5 |
| Molecular Weight (g/mol) | 211.17 |
| MDL Number | MFCD00051968 |
| SMILES | COC(=O)C1=CC=CC(OC)=C1[N+]([O-])=O |
| Synonym | benzoic acid, 3-methoxy-2-nitro-, methyl ester,3-methoxy-2-nitrobenzoic acid methyl ester,m-anisic acid, 2-nitro-, methyl ester,maybridge1_002124,cbmicro_008502,methyl 2-nitro-m-anisate,methyl 3-methoxy-2-nitro-benzoate,2-nitro-m-anisic acid methyl ester,3-methoxy-2-nitro-benzoic acid methyl ester |
| IUPAC Name | methyl 3-methoxy-2-nitrobenzoate |
| InChI Key | FDQQRLPHAAICCR-UHFFFAOYSA-N |
| Molecular Formula | C9H9NO5 |
Benzaldehyde dimethyl acetal, 99%
CAS: 1125-88-8 Molecular Formula: C9H12O2 Molecular Weight (g/mol): 152.193 MDL Number: MFCD00008491 InChI Key: HEVMDQBCAHEHDY-UHFFFAOYSA-N Synonym: benzaldehyde dimethyl acetal,dimethoxymethyl benzene,alpha,alpha-dimethoxytoluene,dimethoxyphenylmethane,benzene, dimethoxymethyl,benzaldehydedimethylacetal,dimethoxymethyl-benzene,benzaldehyde, dimethyl acetal,benzaldehyde dimethylacetal,unii-w6t83k35ca PubChem CID: 62375 IUPAC Name: dimethoxymethylbenzene SMILES: COC(C1=CC=CC=C1)OC
| PubChem CID | 62375 |
|---|---|
| CAS | 1125-88-8 |
| Molecular Weight (g/mol) | 152.193 |
| MDL Number | MFCD00008491 |
| SMILES | COC(C1=CC=CC=C1)OC |
| Synonym | benzaldehyde dimethyl acetal,dimethoxymethyl benzene,alpha,alpha-dimethoxytoluene,dimethoxyphenylmethane,benzene, dimethoxymethyl,benzaldehydedimethylacetal,dimethoxymethyl-benzene,benzaldehyde, dimethyl acetal,benzaldehyde dimethylacetal,unii-w6t83k35ca |
| IUPAC Name | dimethoxymethylbenzene |
| InChI Key | HEVMDQBCAHEHDY-UHFFFAOYSA-N |
| Molecular Formula | C9H12O2 |
Benzyl Alcohol, Multi-Compendial, N.F., J.T. Baker™
CAS: 100-51-6 Molecular Formula: C7H8O Molecular Weight (g/mol): 108.14 MDL Number: MFCD00004599,MFCD03792087 InChI Key: WVDDGKGOMKODPV-UHFFFAOYSA-N Synonym: benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol PubChem CID: 244 ChEBI: CHEBI:17987 IUPAC Name: phenylmethanol SMILES: OCC1=CC=CC=C1
| PubChem CID | 244 |
|---|---|
| CAS | 100-51-6 |
| Molecular Weight (g/mol) | 108.14 |
| ChEBI | CHEBI:17987 |
| MDL Number | MFCD00004599,MFCD03792087 |
| SMILES | OCC1=CC=CC=C1 |
| Synonym | benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol |
| IUPAC Name | phenylmethanol |
| InChI Key | WVDDGKGOMKODPV-UHFFFAOYSA-N |
| Molecular Formula | C7H8O |
2-Bromobenzyl chloride, 97%
CAS: 578-51-8 Molecular Formula: C7H6BrCl Molecular Weight (g/mol): 205.479 MDL Number: MFCD00040863 InChI Key: DDVSFIUKWUTKES-UHFFFAOYSA-N Synonym: 1-bromo-2-chloromethyl benzene,2-bromobenzyl chloride,o-bromobenzyl chloride,benzene,1-bromo-2-chloromethyl,benzene, 1-bromo-2-chloromethyl,o-brombenzylchlorid,acmc-1aunq,3-bromo-2-chloromethylbenzene,1-bromo-2-chloromethyl benzene # PubChem CID: 521816 IUPAC Name: 1-bromo-2-(chloromethyl)benzene SMILES: C1=CC=C(C(=C1)CCl)Br
| PubChem CID | 521816 |
|---|---|
| CAS | 578-51-8 |
| Molecular Weight (g/mol) | 205.479 |
| MDL Number | MFCD00040863 |
| SMILES | C1=CC=C(C(=C1)CCl)Br |
| Synonym | 1-bromo-2-chloromethyl benzene,2-bromobenzyl chloride,o-bromobenzyl chloride,benzene,1-bromo-2-chloromethyl,benzene, 1-bromo-2-chloromethyl,o-brombenzylchlorid,acmc-1aunq,3-bromo-2-chloromethylbenzene,1-bromo-2-chloromethyl benzene # |
| IUPAC Name | 1-bromo-2-(chloromethyl)benzene |
| InChI Key | DDVSFIUKWUTKES-UHFFFAOYSA-N |
| Molecular Formula | C7H6BrCl |
m-Tolualdehyde, 97%, stab. with 0.1% hydroquinone
CAS: 620-23-5 Molecular Formula: C8H8O Molecular Weight (g/mol): 120.151 MDL Number: MFCD00003374 InChI Key: OVWYEQOVUDKZNU-UHFFFAOYSA-N Synonym: m-tolualdehyde,benzaldehyde, 3-methyl,m-methylbenzaldehyde,3-tolylaldehyde,3-tolualdehyde,m-tolyl aldehyde,m-toluylaldehyde,3-methyl-benzaldehyd,unii-owh6650c4y,3-methyl benzaldehyde PubChem CID: 12105 ChEBI: CHEBI:28476 IUPAC Name: 3-methylbenzaldehyde SMILES: CC1=CC=CC(=C1)C=O
| PubChem CID | 12105 |
|---|---|
| CAS | 620-23-5 |
| Molecular Weight (g/mol) | 120.151 |
| ChEBI | CHEBI:28476 |
| MDL Number | MFCD00003374 |
| SMILES | CC1=CC=CC(=C1)C=O |
| Synonym | m-tolualdehyde,benzaldehyde, 3-methyl,m-methylbenzaldehyde,3-tolylaldehyde,3-tolualdehyde,m-tolyl aldehyde,m-toluylaldehyde,3-methyl-benzaldehyd,unii-owh6650c4y,3-methyl benzaldehyde |
| IUPAC Name | 3-methylbenzaldehyde |
| InChI Key | OVWYEQOVUDKZNU-UHFFFAOYSA-N |
| Molecular Formula | C8H8O |
2-Chloro-5-nitrobenzaldehyde, 97%
CAS: 6361-21-3 Molecular Formula: C7H4ClNO3 Molecular Weight (g/mol): 185.56 MDL Number: MFCD00007293 InChI Key: VFVHWCKUHAEDMY-UHFFFAOYSA-N Synonym: benzaldehyde, 2-chloro-5-nitro,3-nitro-6-chlorobenzaldehyde,2-chloro-5-nitro-benzaldehyde,unii-pf4ill0i3h,pf4ill0i3h,2-chlor-5-nitrobenzaldehyd,pubchem7375,wln: wnr dg cvh,chloro-5-nitrobenzaldehyde,asischem r37046 PubChem CID: 72933 IUPAC Name: 2-chloro-5-nitrobenzaldehyde SMILES: [O-][N+](=O)C1=CC=C(Cl)C(C=O)=C1
| PubChem CID | 72933 |
|---|---|
| CAS | 6361-21-3 |
| Molecular Weight (g/mol) | 185.56 |
| MDL Number | MFCD00007293 |
| SMILES | [O-][N+](=O)C1=CC=C(Cl)C(C=O)=C1 |
| Synonym | benzaldehyde, 2-chloro-5-nitro,3-nitro-6-chlorobenzaldehyde,2-chloro-5-nitro-benzaldehyde,unii-pf4ill0i3h,pf4ill0i3h,2-chlor-5-nitrobenzaldehyd,pubchem7375,wln: wnr dg cvh,chloro-5-nitrobenzaldehyde,asischem r37046 |
| IUPAC Name | 2-chloro-5-nitrobenzaldehyde |
| InChI Key | VFVHWCKUHAEDMY-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClNO3 |